Introduction：Basic information about CAS 19013-11-7|4-methyl-3-nitrobenzamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-methyl-3-nitrobenzamide |
|---|
| CAS Number | 19013-11-7 | Molecular Weight | 180.16100 |
|---|
| Density | 1.322g/cm3 | Boiling Point | 291.7ºC at 760mmHg |
|---|
| Molecular Formula | C8H8N2O3 | Melting Point | 164-165°C |
|---|
| MSDS | / | Flash Point | 130.2ºC |
|---|
Names
| Name | 4-methyl-3-nitrobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.322g/cm3 |
|---|
| Boiling Point | 291.7ºC at 760mmHg |
|---|
| Melting Point | 164-165°C |
|---|
| Molecular Formula | C8H8N2O3 |
|---|
| Molecular Weight | 180.16100 |
|---|
| Flash Point | 130.2ºC |
|---|
| Exact Mass | 180.05300 |
|---|
| PSA | 88.91000 |
|---|
| LogP | 2.22560 |
|---|
| Vapour Pressure | 0.00192mmHg at 25°C |
|---|
| Index of Refraction | 1.599 |
|---|
| InChIKey | YEUGEQUFPMJGCD-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(N)=O)cc1[N+](=O)[O-] |
|---|
Safety Information
| Risk Phrases | 22 |
|---|
| Safety Phrases | S22-S36/37 |
|---|
| RIDADR | 2811 |
|---|
| Packaging Group | III |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 4-Methyl-3-nitro-benzoesaeure-amid |
| 3-Nitro-4-methyl-benzamid |
| 4-Methyl-3-nitrobenzamide |
| MFCD00027392 |
| 3-Nitro-4-methylbenzamide |
| 3-Nitro-p-toluylsaeure-amid |
| 4-methyl-3-nitro-benzamide |
| 4-methyl-3-nitro-benzoic acid amide |
| EINECS 242-752-4 |
