Introduction：Basic information about CAS 83833-32-3|2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane |
|---|
| CAS Number | 83833-32-3 | Molecular Weight | 275.17100 |
|---|
| Density | 1.189g/cm3 | Boiling Point | 339.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16Cl2O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 117.9ºC |
|---|
Names
| Name | 2-(2,4-Dichlorophenyl)-2-methyl-4-propyl-1,3-dioxolane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.189g/cm3 |
|---|
| Boiling Point | 339.1ºC at 760 mmHg |
|---|
| Molecular Formula | C13H16Cl2O2 |
|---|
| Molecular Weight | 275.17100 |
|---|
| Flash Point | 117.9ºC |
|---|
| Exact Mass | 274.05300 |
|---|
| PSA | 18.46000 |
|---|
| LogP | 4.38160 |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | ZOVODRUFYPBAKW-UHFFFAOYSA-N |
|---|
| SMILES | CCCC1COC(C)(c2ccc(Cl)cc2Cl)O1 |
|---|
Synonyms
| EINECS 281-007-8 |
| 2-(2,4-Dichlorophenyl)-2-methyl-4-propyldioxolane |
| 1,3-Dioxolane,2-(2,4-dichlorophenyl)-2-methyl-4-propyl |
