Introduction：Basic information about CAS 21401-55-8|di(1H-pyrrol-2-yl)methanethione, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | di(1H-pyrrol-2-yl)methanethione |
|---|
| CAS Number | 21401-55-8 | Molecular Weight | 176.238 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 408.9±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8N2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 201.1±28.2 °C |
|---|
Names
| Name | bis-(1H-pyrrol-2-yl)-methanethione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 408.9±43.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H8N2S |
|---|
| Molecular Weight | 176.238 |
|---|
| Flash Point | 201.1±28.2 °C |
|---|
| Exact Mass | 176.040817 |
|---|
| PSA | 63.67000 |
|---|
| LogP | -0.12 |
|---|
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
|---|
| Index of Refraction | 1.720 |
|---|
| InChIKey | GZKUQYLJLFWZLO-UHFFFAOYSA-N |
|---|
| SMILES | S=C(c1ccc[nH]1)c1ccc[nH]1 |
|---|
Synonyms
| di(1H-pyrrol-2-yl)methanethione |
| Di-(2-pyrryl)thioketone |
| bis(1H-pyrrol-2-yl)methanethione |
| Methanethione, di-1H-pyrrol-2-yl- |
| Di-1H-pyrrol-2-ylmethanethione |
| 2,2'-dipyrrolylthioketone |
| 2,2'-dipyrrolyl thioketone |
| bis(1H-pyrrol-2-yl)-methanethione |
| 2,2'-dipyrryl thioketone |
