Introduction：Basic information about CAS 5581-67-9|Methyl Triisopropoxysilane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl Triisopropoxysilane |
|---|
| CAS Number | 5581-67-9 | Molecular Weight | 220.381 |
|---|
| Density | 0.9±0.1 g/cm3 | Boiling Point | 159.8±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H24O3Si | Melting Point | / |
|---|
| MSDS | / | Flash Point | 55.8±19.0 °C |
|---|
Names
| Name | methyl-tri(propan-2-yloxy)silane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 0.9±0.1 g/cm3 |
|---|
| Boiling Point | 159.8±8.0 °C at 760 mmHg |
|---|
| Molecular Formula | C10H24O3Si |
|---|
| Molecular Weight | 220.381 |
|---|
| Flash Point | 55.8±19.0 °C |
|---|
| Exact Mass | 220.149475 |
|---|
| PSA | 27.69000 |
|---|
| LogP | 2.77 |
|---|
| Vapour Pressure | 3.2±0.3 mmHg at 25°C |
|---|
| Index of Refraction | 1.413 |
|---|
| InChIKey | HLXDKGBELJJMHR-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)O[Si](C)(OC(C)C)OC(C)C |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| RIDADR | UN 1993 |
|---|
Synonyms
| METHYL-TRIISOPROPOXY-SILANE |
| (CH3)Si(Oi-C3H7)3 |
| Silane, methyltris(1-methylethoxy)- |
| Triisopropoxy(methyl)silane |
| triisopropoxy-methyl-silane |
| Triisopropoxy-methyl-silan |
| methyltriisopropyloxysilane |
| methyl[tris(propan-2-yloxy)]silane |
| Silane,methyltris(1-methylethoxy) |
| Methyltris(1-methylethoxy)silane |
| Methyl Triisopropoxysilane |
