Introduction:Basic information about CAS 20541-49-5|Diselenide,bis(4-chlorophenyl), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Diselenide,bis(4-chlorophenyl) |
|---|
| CAS Number | 20541-49-5 | Molecular Weight | 381.01800 |
|---|
| Density | / | Boiling Point | 424.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H8Cl2Se2 | Melting Point | 85-88ºC |
|---|
| MSDS | / | Flash Point | 210.4ºC |
|---|
Names
| Name | 1-chloro-4-[(4-chlorophenyl)diselanyl]benzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 424.2ºC at 760 mmHg |
|---|
| Melting Point | 85-88ºC |
|---|
| Molecular Formula | C12H8Cl2Se2 |
|---|
| Molecular Weight | 381.01800 |
|---|
| Flash Point | 210.4ºC |
|---|
| Exact Mass | 381.83300 |
|---|
| LogP | 2.26760 |
|---|
| Vapour Pressure | 5.19E-07mmHg at 25°C |
|---|
| InChIKey | DVGQWQMPCZYJLR-UHFFFAOYSA-N |
|---|
| SMILES | Clc1ccc([Se][Se]c2ccc(Cl)cc2)cc1 |
|---|
Safety Information
| Hazard Codes | T,N |
|---|
| Risk Phrases | R33;R23/25;R50/53 |
|---|
| Safety Phrases | S28;S45;S60;S61 |
|---|
| RIDADR | UN 2811 |
|---|
| Packaging Group | III |
|---|
| Hazard Class | 6.1(b) |
|---|
| HS Code | 2903999090 |
|---|
Customs
| HS Code | 2903999090 |
|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 1,2-bis(4-chlorophenyl)diselenide |
| Bis(p-chlorophenyl) diselenide |
| 1,2-bis(4-chlorophenyl)diselane |
| 4-Chlorophenyl diselenide |
| bis(4-chlorophenyl)diselane |
| EINECS 243-864-6 |
| di-(4-chlorophenyl)-diselenide |
| bis(4-chlorophenyl)diselenide |
| (4-ClPhSe)2 |