Introduction：Basic information about CAS 2160-55-6|1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-(5-BROMO-4-NITRO-2-THIENYL)ETHAN-1-ONE |
|---|
| CAS Number | 2160-55-6 | Molecular Weight | 250.07000 |
|---|
| Density | 1.805g/cm3 | Boiling Point | 302.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H4BrNO3S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 136.6ºC |
|---|
Names
| Name | 1-(5-bromo-4-nitrothiophen-2-yl)ethanone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.805g/cm3 |
|---|
| Boiling Point | 302.3ºC at 760 mmHg |
|---|
| Molecular Formula | C6H4BrNO3S |
|---|
| Molecular Weight | 250.07000 |
|---|
| Flash Point | 136.6ºC |
|---|
| Exact Mass | 248.91000 |
|---|
| PSA | 91.13000 |
|---|
| LogP | 3.14460 |
|---|
| Vapour Pressure | 0.000997mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | MSWCULJVEJDHGN-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(Br)s1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-(5-bromo-4-nitro-[2]thienyl)-ethanone |
| 1-(5-Brom-4-nitro-[2]thienyl)-aethanon |
| 1-(5-Bromo-4-nitro-2-thienyl)ethan-1-one |
| 2-Brom-3-nitro-5-acetyl-thiophen |
| 1-(5-bromo-4-nitro-thiophen-2-yl)-ethanone |
| 2-Acetyl-5-bromo-4-nitrothiophene |
| 5-Acetyl-2-brom-3-nitrothiophen |
| 2-bromo-3-nitro-5-acetyl thiophene |
