Introduction：Basic information about CAS 4335-28-8|6-Phenyl-2,3-dihydroimidazo[2,1-b]thiazole, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-Phenyl-2,3-dihydroimidazo[2,1-b]thiazole |
|---|
| CAS Number | 4335-28-8 | Molecular Weight | 202.27500 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C11H10N2S | Melting Point | 147ºC |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 6-phenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazole |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 147ºC |
|---|
| Molecular Formula | C11H10N2S |
|---|
| Molecular Weight | 202.27500 |
|---|
| Exact Mass | 202.05600 |
|---|
| PSA | 43.12000 |
|---|
| LogP | 2.65580 |
|---|
| InChIKey | ZUSMDKHVRFBRNJ-UHFFFAOYSA-N |
|---|
| SMILES | c1ccc(-c2cn3c(n2)SCC3)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934100090 |
|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| 2,3-diidro-6-fenilimidazo<tiazolo |
| 6-Phenyl-imidazo<2,1-b>thiazolin |
| BUTTPARK 41-71 |
| 6-phenyl-imidazo-thiazolidine |
| 6-Phenyl-2,3-dihydro1midazo[2,1-b][1,3]thiazole |
| 6-Phenyl-2,3-dihydroimidazo[2,1-b]thiazole |
