Introduction：Basic information about CAS 955-54-4|2-(4-Chlorophenylthio)Nicotinic Acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-(4-Chlorophenylthio)Nicotinic Acid |
|---|
| CAS Number | 955-54-4 | Molecular Weight | 265.71500 |
|---|
| Density | 1.48g/cm3 | Boiling Point | 447.3ºC at 760mmHg |
|---|
| Molecular Formula | C12H8ClNO2S | Melting Point | 218ºC |
|---|
| MSDS | / | Flash Point | 224.3ºC |
|---|
Names
| Name | 2-(4-chlorophenyl)sulfanylpyridine-3-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Boiling Point | 447.3ºC at 760mmHg |
|---|
| Melting Point | 218ºC |
|---|
| Molecular Formula | C12H8ClNO2S |
|---|
| Molecular Weight | 265.71500 |
|---|
| Flash Point | 224.3ºC |
|---|
| Exact Mass | 264.99600 |
|---|
| PSA | 75.49000 |
|---|
| LogP | 3.58440 |
|---|
| InChIKey | FPKVNUOJWZFDNZ-UHFFFAOYSA-N |
|---|
| SMILES | O=C(O)c1cccnc1Sc1ccc(Cl)cc1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36/37/39 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| Chlorphenylthionicotinsaeure |
| 2-(4-chlorophenylthio)pyridine-3-carboxylic acid |
| 2-(4-chlorophenylthio)-3-pyridine carboxylic acid |
| 2-[(4-chlorophenyl)sulfanyl]pyridine-3-carboxylic acid |
| 2-[(4-chlorophenyl)thio]nicotinic acid |
| MFCD00052117 |
| 2-(p-Chlorphenylthio)-3-carboxypyridin |
| 2-(4-chloro-phenylsulfanyl)-nicotinic acid |
| 2-(2-HYDROXY-ETHYL)-6-METHYL-4H-BENZO[1,4]OXAZIN-3-ONE |
