Introduction：Basic information about CAS 423768-42-7|5-methyl-1-(2-methylphenyl)pyrazole-4-carbonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 5-methyl-1-(2-methylphenyl)pyrazole-4-carbonyl chloride |
|---|
| CAS Number | 423768-42-7 | Molecular Weight | 234.68200 |
|---|
| Density | 1.24g/cm3 | Boiling Point | 134ºC |
|---|
| Molecular Formula | C12H11ClN2O | Melting Point | / |
|---|
| MSDS | / | Flash Point | 168.6ºC |
|---|
Names
| Name | 5-methyl-1-(2-methylphenyl)pyrazole-4-carbonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.24g/cm3 |
|---|
| Boiling Point | 134ºC |
|---|
| Molecular Formula | C12H11ClN2O |
|---|
| Molecular Weight | 234.68200 |
|---|
| Flash Point | 168.6ºC |
|---|
| Exact Mass | 234.05600 |
|---|
| PSA | 34.89000 |
|---|
| LogP | 2.86810 |
|---|
| Index of Refraction | 1.601 |
|---|
| InChIKey | MHSWLGGUNFSGJR-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccccc1-n1ncc(C(=O)Cl)c1C |
|---|
Safety Information
| Hazard Codes | C:Corrosive |
|---|
| Risk Phrases | R34 |
|---|
| Safety Phrases | S26-S36/37/39-S45 |
|---|
Synonyms
| 5-methyl-1-(2-methylphenyl)-1H-pyrazole-4-carbonyl chloride |
