Introduction：Basic information about CAS 3586-15-0|3-phenoxybenzoyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 3-phenoxybenzoyl chloride |
|---|
| CAS Number | 3586-15-0 | Molecular Weight | 232.66200 |
|---|
| Density | 1.247g/cm3 | Boiling Point | 330ºC at 760mmHg |
|---|
| Molecular Formula | C13H9ClO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 122.4ºC |
|---|
Names
| Name | 3-phenoxybenzoyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.247g/cm3 |
|---|
| Boiling Point | 330ºC at 760mmHg |
|---|
| Molecular Formula | C13H9ClO2 |
|---|
| Molecular Weight | 232.66200 |
|---|
| Flash Point | 122.4ºC |
|---|
| Exact Mass | 232.02900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.85790 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | TTZXIWBOKOZOPL-UHFFFAOYSA-N |
|---|
| SMILES | O=C(Cl)c1cccc(Oc2ccccc2)c1 |
|---|
Safety Information
| Hazard Codes | C: Corrosive; |
|---|
| HS Code | 2918990090 |
|---|
Customs
| HS Code | 2918990090 |
|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| 3-Phenoxy-benzoesaeure-chlorid |
| 3-phenoxybenzoic acid chloride |
| m-phenoxybenzoyl chloride |
| meta-phenoxybenzoyl chloride |
| Benzoyl chloride,3-phenoxy |
| 3-phenoxy-benzoyl chloride |
