Introduction：Basic information about CAS 7578-68-9|4-Oxo-2-phenyl-4H-chromen-3-yl acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-Oxo-2-phenyl-4H-chromen-3-yl acetate |
|---|
| CAS Number | 7578-68-9 | Molecular Weight | 280.275 |
|---|
| Density | 1.319g/cm3 | Boiling Point | 421.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H12O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 187.4±28.8 °C |
|---|
Names
| Name | (4-oxo-2-phenylchromen-3-yl) acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.319g/cm3 |
|---|
| Boiling Point | 421.1±45.0 °C at 760 mmHg |
|---|
| Molecular Formula | C17H12O4 |
|---|
| Molecular Weight | 280.275 |
|---|
| Flash Point | 187.4±28.8 °C |
|---|
| Exact Mass | 280.073547 |
|---|
| PSA | 56.51000 |
|---|
| LogP | 3.06 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.632 |
|---|
| InChIKey | NCHSTTAWIMAJHU-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)Oc1c(-c2ccccc2)oc2ccccc2c1=O |
|---|
Synonyms
| 3-acetoxy-2-phenyl-chromen-4-one |
| 3-Acetoxy-flavon |
| 3-acetoxyflavonol |
| 3-acetoxyflavone |
| 4H-1-Benzopyran-4-one, 3-(acetyloxy)-2-phenyl- |
| 4-Oxo-2-phenyl-4H-chromen-3-yl acetate |
| 3-Acetoxy-2-phenyl-chromen-4-on |
