Introduction：Basic information about CAS 67593-46-8|2-Acetyl-3-(2-chlorophenyl)acrylic acid methyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Acetyl-3-(2-chlorophenyl)acrylic acid methyl ester |
|---|
| CAS Number | 67593-46-8 | Molecular Weight | 238.66700 |
|---|
| Density | 1.241 g/cm3 | Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 142.6ºC |
|---|
Names
| Name | Methyl 2-(2-chlorobenzylidene)-3-oxobutanoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.241 g/cm3 |
|---|
| Boiling Point | 347.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H11ClO3 |
|---|
| Molecular Weight | 238.66700 |
|---|
| Flash Point | 142.6ºC |
|---|
| Exact Mass | 238.04000 |
|---|
| PSA | 43.37000 |
|---|
| LogP | 2.48540 |
|---|
| Index of Refraction | 1.564 |
|---|
| InChIKey | MNMKWCPLHQYQLU-JXMROGBWSA-N |
|---|
| SMILES | COC(=O)C(=Cc1ccccc1Cl)C(C)=O |
|---|
Synonyms
| MFCD06658526 |
| methyl 2-[(2-chlorophenyl)methylidene]-3-oxobutanoate |
