Introduction:Basic information about CAS 305-72-6|Sodium 2-oxopentanedioate hydrate (2:1:2), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Sodium 2-oxopentanedioate hydrate (2:1:2) |
|---|
| CAS Number | 305-72-6 | Molecular Weight | 226.092 |
|---|
| Density | 1.499g/cm3 | Boiling Point | 345.6ºC at 760 mmHg |
|---|
| Molecular Formula | C5H8Na2O7 | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 177ºC |
|---|
Names
| Name | Disodium 2-oxoglutarate dihydrate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.499g/cm3 |
|---|
| Boiling Point | 345.6ºC at 760 mmHg |
|---|
| Molecular Formula | C5H8Na2O7 |
|---|
| Molecular Weight | 226.092 |
|---|
| Flash Point | 177ºC |
|---|
| Exact Mass | 226.006546 |
|---|
| PSA | 115.79000 |
|---|
| InChIKey | YBGBJYVHJTVUSL-UHFFFAOYSA-L |
|---|
| SMILES | O=C([O-])CCC(=O)C(=O)[O-].[Na+].[Na+] |
|---|
| Storage condition | 2-8°C |
|---|
| Water Solubility | soluble |
|---|
Safety Information
| Hazard Codes | T |
|---|
| Risk Phrases | R23/24/25:Toxic by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|
| Safety Phrases | S22-S24/25 |
|---|
| WGK Germany | 3 |
|---|
| RTECS | SA0454700 |
|---|
| HS Code | 2918300090 |
|---|
Customs
| HS Code | 2918300090 |
|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|---|
Synonyms
| μ-[2-Oxopentanedioato(2-)-κO:κO]disodium dihydrate |
| 2-oxoglutaric acid disodium salt |
| pentanedioic acid, 2-oxo-, sodium salt, hydrate (1:2:2) |
| Disodium 2-oxopentanedioate |
| EINECS 206-167-8 |
| Sodium 2-oxopentanedioate hydrate (2:1:2) |
| Disodium 2-oxoglutar |
| Disodium 2-Ketoglutarate |
| KetoglutaricAcid,Disodium |
| monosodium 2-oxoglutarate |
| A-KETOGLUTARIC ACID DISODIUM |
| sodium-ketoglutarate |
| 2-Ketoglutaric acid |
| Sodium, μ-[2-oxopentanedioato(2-)-κO:κO]-, hydrate (1:2) |
| Disodium 2-Oxoglutarate |
| 2-Ketoglutaric Acid Disodium Salt |
| MFCD00043347 |