Introduction:Basic information about CAS 110956-75-7|pentoxazone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | pentoxazone |
|---|
| CAS Number | 110956-75-7 | Molecular Weight | 353.77300 |
|---|
| Density | 1.388g/cm3 | Boiling Point | 463.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H17ClFNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 234ºC |
|---|
Names
| Name | pentoxazone |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.388g/cm3 |
|---|
| Boiling Point | 463.3ºC at 760mmHg |
|---|
| Molecular Formula | C17H17ClFNO4 |
|---|
| Molecular Weight | 353.77300 |
|---|
| Flash Point | 234ºC |
|---|
| Exact Mass | 353.08300 |
|---|
| PSA | 55.84000 |
|---|
| LogP | 4.64260 |
|---|
| Vapour Pressure | 0mmHg at 25°C |
|---|
| Index of Refraction | 1.583 |
|---|
| InChIKey | JZPKLLLUDLHCEL-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)=C1OC(=O)N(c2cc(OC3CCCC3)c(Cl)cc2F)C1=O |
|---|
Synonyms
| 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-isopropylidene-1,3-oxazolidine-2,4-dione |
| Pentoxazone |
| 3-(4-chloro-5-cyclopentyloxy-2-fluorophenyl)-5-propan-2-ylidene-1,3-oxazolidine-2,4-dione |
| 3-[4-chloro-5-(cyclopentyloxy)-2-fluorophenyl]-5-(propan-2-ylidene)-1,3-oxazolidine-2,4-dione |
| 3-[4-chloro-5-(cyclopentyloxy)-2-fluorophenyl]-5-(1-methylethylidene)-2,4-oxazolidinedione |
| Pentoxazone [ISO] |