Introduction：Basic information about CAS 2672-57-3|trimethyl 1,2,3-benzenetricarboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | trimethyl 1,2,3-benzenetricarboxylate |
|---|
| CAS Number | 2672-57-3 | Molecular Weight | 252.22000 |
|---|
| Density | 1.241g/cm3 | Boiling Point | 291.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 123.2ºC |
|---|
Names
| Name | trimethyl 1,2,3-benzenetricarboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.241g/cm3 |
|---|
| Boiling Point | 291.2ºC at 760 mmHg |
|---|
| Molecular Formula | C12H12O6 |
|---|
| Molecular Weight | 252.22000 |
|---|
| Flash Point | 123.2ºC |
|---|
| Exact Mass | 252.06300 |
|---|
| PSA | 78.90000 |
|---|
| LogP | 1.04640 |
|---|
| Vapour Pressure | 0.00198mmHg at 25°C |
|---|
| Index of Refraction | 1.518 |
|---|
| InChIKey | SBOCVSUCRFVXFE-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)c1cccc(C(=O)OC)c1C(=O)OC |
|---|
Synonyms
| 1,2,3-benzenetricarboxylicacid,trimethylester |
| trimethyl benzene-1,2,3-tricarboxylate |
| trimethyl hemimellitate |
| Benzene-1,2,3-tricarboxylic acid,trimethyl ester |
| Benzol-1,2,3-tricarbonsaeure-trimethylester |
| Hemimellitsaeure-trimethylester |
| 1.2.3-Benzoltricarboxylsaeuretrimethylester |
| hemimelliticacid,trimethylester |
| 1,2,3-Benzenetricarboxylic acid trimethyl |
