Introduction:Basic information about CAS 3034-04-6|6-methoxyflavanone, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 6-methoxyflavanone |
|---|
| CAS Number | 3034-04-6 | Molecular Weight | 254.28100 |
|---|
| Density | 1.199g/cm3 | Boiling Point | 425.5ºC at 760mmHg |
|---|
| Molecular Formula | C16H14O3 | Melting Point | 141-143 °C(lit.) |
|---|
| MSDS | / | Flash Point | 202.9ºC |
|---|
Names
| Name | 6-methoxy-2-phenyl-2,3-dihydrochromen-4-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.199g/cm3 |
|---|
| Boiling Point | 425.5ºC at 760mmHg |
|---|
| Melting Point | 141-143 °C(lit.) |
|---|
| Molecular Formula | C16H14O3 |
|---|
| Molecular Weight | 254.28100 |
|---|
| Flash Point | 202.9ºC |
|---|
| Exact Mass | 254.09400 |
|---|
| PSA | 35.53000 |
|---|
| LogP | 3.40170 |
|---|
| Index of Refraction | 1.587 |
|---|
| InChIKey | YURQMHCZHLMHIB-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc2c(c1)C(=O)CC(c1ccccc1)O2 |
|---|
Safety Information
| Hazard Codes | Xi:Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S36/37/39-S26 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2932999099 |
|---|
Customs
| HS Code | 2932999099 |
|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 6-Methoxy-2-phenyl-chroman-4-on |
| 6-Methoxyflavanone |
| MFCD00017484 |
| 6-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| 6-methoxy-2-phenylchroman-4-one |
| Flavanone,6-methoxy |
| 6-methoxyflavanon |