Introduction:Basic information about CAS 352351-62-3|Fmoc-D-phe(2,4-Cl2)-OH, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Fmoc-D-phe(2,4-Cl2)-OH |
|---|
| CAS Number | 352351-62-3 | Molecular Weight | 456.318 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 659.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H19Cl2NO4 | Melting Point | / |
|---|
| MSDS | ChineseUSA | Flash Point | 352.9±31.5 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | (2S)-3-(2,4-dichlorophenyl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 659.9±55.0 °C at 760 mmHg |
|---|
| Molecular Formula | C24H19Cl2NO4 |
|---|
| Molecular Weight | 456.318 |
|---|
| Flash Point | 352.9±31.5 °C |
|---|
| Exact Mass | 455.069122 |
|---|
| PSA | 75.63000 |
|---|
| LogP | 6.61 |
|---|
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
|---|
| Index of Refraction | 1.642 |
|---|
| InChIKey | PGIMVGROPOKRNA-QFIPXVFZSA-N |
|---|
| SMILES | O=C(NC(Cc1ccc(Cl)cc1Cl)C(=O)O)OCC1c2ccccc2-c2ccccc21 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| Risk Phrases | 36/37/38 |
|---|
| Safety Phrases | 26-36 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
Synonyms
| Fmoc-2,4-dichloro-L-phenylalanine |
| Fmoc-Phe(2,4-Cl2)-OH |
| L-Phenylalanine, 2,4-dichloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-L-2,4-Dichlorophenylalanine |
| Fmoc-D-phe(2,4-Cl2)-OH |
| 2,4-Dichloro-L-phenylalanine,N-FMOC protected |
| (2S)-3-(2,4-Dichlorophenyl)-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}propanoic acid |
| 2,4-Dichloro-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-phenylalanine |
| FMOC-L-2,4-DICHLOROPHE |
| (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid |
| Fmoc-L-phe(2,4-Cl2)-OH |