Introduction:Basic information about CAS 1548-74-9|Benzamide,4-amino-2,3,5,6-tetrafluoro-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzamide,4-amino-2,3,5,6-tetrafluoro- |
|---|
| CAS Number | 1548-74-9 | Molecular Weight | 208.11300 |
|---|
| Density | 1.635g/cm3 | Boiling Point | 148.4ºC at 760mmHg |
|---|
| Molecular Formula | C7H4F4N2O | Melting Point | 185-186 °C(lit.) |
|---|
| MSDS | / | Flash Point | 43.5ºC |
|---|
Names
| Name | 4-amino-2,3,5,6-tetrafluorobenzamide |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.635g/cm3 |
|---|
| Boiling Point | 148.4ºC at 760mmHg |
|---|
| Melting Point | 185-186 °C(lit.) |
|---|
| Molecular Formula | C7H4F4N2O |
|---|
| Molecular Weight | 208.11300 |
|---|
| Flash Point | 43.5ºC |
|---|
| Exact Mass | 208.02600 |
|---|
| PSA | 69.11000 |
|---|
| LogP | 2.20560 |
|---|
| Vapour Pressure | 4.23mmHg at 25°C |
|---|
| Index of Refraction | 1.531 |
|---|
| InChIKey | CAERPAFTLPIDJT-UHFFFAOYSA-N |
|---|
| SMILES | NC(=O)c1c(F)c(F)c(N)c(F)c1F |
|---|
Safety Information
| Hazard Codes | Xi: Irritant; |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S37/39 |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2924299090 |
|---|
Customs
| HS Code | 2924299090 |
|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|---|
Synonyms
| AC1L2KH4 |
| 4-Amino-2,3,5,6-tetrafluorobenzamide |
| ACMC-1CUJP |
| AC1Q4N5V |
| 4-Aminotetrafluorobenzamide |
| 4-Amino-tetrafluor-benzamid |
| MFCD00008000 |
| EINECS 216-285-1 |
| 2.3.5.6-Tetrafluor-4-amino-benzamid |