Introduction:Basic information about CAS 38533-61-8|2-Chloro-6-methoxy-3-nitropyridine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-6-methoxy-3-nitropyridine |
|---|
| CAS Number | 38533-61-8 | Molecular Weight | 188.568 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 298.5±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C6H5ClN2O3 | Melting Point | 78-80 °C(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | 134.4±25.9 °C |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-Chloro-6-methoxy-3-nitropyridine |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 298.5±35.0 °C at 760 mmHg |
|---|
| Melting Point | 78-80 °C(lit.) |
|---|
| Molecular Formula | C6H5ClN2O3 |
|---|
| Molecular Weight | 188.568 |
|---|
| Flash Point | 134.4±25.9 °C |
|---|
| Exact Mass | 187.998871 |
|---|
| PSA | 67.94000 |
|---|
| LogP | 2.02 |
|---|
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
|---|
| Index of Refraction | 1.565 |
|---|
| InChIKey | DVRGUTNVDGIKTP-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccc([N+](=O)[O-])c(Cl)n1 |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xn:Harmful; |
|---|
| Risk Phrases | R20/21/22;R36/37/38;R44 |
|---|
| Safety Phrases | S26-S37/39-S36/37/39 |
|---|
| RIDADR | NONH for all modes of transport |
|---|
| WGK Germany | 3 |
|---|
| HS Code | 2933399090 |
|---|
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-chloro-6-(methyloxy)-3-nitropyridine |
| MFCD00130268 |
| Pyridine, 2-chloro-6-methoxy-3-nitro- |
| EINECS 253-989-8 |
| 2-Chloro-6-methoxy-3-nitro-pyridine |
| 2-Chloro-6-methoxy-3-nitropyridine |
| 2-Chloro-3-Nitro-6-Methoxypyridine |
| 2-chloro-6-methoxy-3-nitropyrimidine |