Introduction：Basic information about CAS 21320-90-1|2-Methyl-4-nitrobenzene-1-sulfonyl chloride, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Methyl-4-nitrobenzene-1-sulfonyl chloride |
|---|
| CAS Number | 21320-90-1 | Molecular Weight | 235.64500 |
|---|
| Density | 1.528g/cm3 | Boiling Point | 370.3ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 177.8ºC |
|---|
Names
| Name | 2-methyl-4-nitrobenzenesulfonyl chloride |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.528g/cm3 |
|---|
| Boiling Point | 370.3ºC at 760 mmHg |
|---|
| Molecular Formula | C7H6ClNO4S |
|---|
| Molecular Weight | 235.64500 |
|---|
| Flash Point | 177.8ºC |
|---|
| Exact Mass | 234.97100 |
|---|
| PSA | 88.34000 |
|---|
| LogP | 3.43470 |
|---|
| Vapour Pressure | 2.38E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | WREICNIHNBOUJV-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cc([N+](=O)[O-])ccc1S(=O)(=O)Cl |
|---|
Safety Information
Customs
| HS Code | 2904909090 |
|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|---|
Synonyms
| 5-Nitro-toluol-2-sulfonylchlorid |
| 5-nitro-toluene-2-sulfonyl chloride |
| 5-Nitrotoluene-2-sulphonyl chloride |
| 5-nitro-2-toluenesulfonyl chloride |
| 5-nitro-o-toluenesulfonyl chloride |
| EINECS 244-332-6 |
| 4-nitro-2-methylbenzenesulfonyl chloride |
