Introduction：Basic information about CAS 15990-43-9|N-Benzylniacin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-Benzylniacin |
|---|
| CAS Number | 15990-43-9 | Molecular Weight | 213.232 |
|---|
| Density | 1.09 | Boiling Point | / |
|---|
| Molecular Formula | C13H11NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 1-benzylpyridin-1-ium-3-carboxylate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.09 |
|---|
| Molecular Formula | C13H11NO2 |
|---|
| Molecular Weight | 213.232 |
|---|
| Exact Mass | 213.078979 |
|---|
| PSA | 44.01000 |
|---|
| LogP | -2.74 |
|---|
| Index of Refraction | 1.625 |
|---|
| InChIKey | AVWFAACIXBQMBF-UHFFFAOYSA-N |
|---|
| SMILES | O=C([O-])c1ccc[n+](Cc2ccccc2)c1 |
|---|
Safety Information
Customs
| HS Code | 2933399090 |
|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 1-Benzyl-3-carboxylatopyridinium |
| 1-benzyl-3-carboxy-pyridinium betaine |
| N-benzyl nicotinic acid |
| N-Benzylniacin |
| Pyridinium, 3-carboxy-1-(phenylmethyl)-, inner salt |
| 1-benzylpyridinium-3-carboxylate |
| 1-Benzyl-3-carboxy-pyridinium-betain |
| N-Benzylnicotinsaeure |
| 1-Benzyl-3-pyridiniumcarboxylate |
| Pyridinium,3-carboxy-1-(phenylmethyl)-,hydroxide,inner salt |
| EINECS 240-129-1 |
| MFCD00023577 |
| Pyridinium,3-carboxy-1-(phenylmethyl)-,inner salt |
| Benzyl pyridinium 3-carboxylate |
