Introduction:Basic information about CAS 26447-85-8|Methyl 2,2-dithienylglycolate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Methyl 2,2-dithienylglycolate |
|---|
| CAS Number | 26447-85-8 | Molecular Weight | 254.325 |
|---|
| Density | 1.4±0.1 g/cm3 | Boiling Point | 406.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10O3S2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 199.6±27.3 °C |
|---|
Names
| Name | methyl 2-hydroxy-2,2-dithiophen-2-ylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.4±0.1 g/cm3 |
|---|
| Boiling Point | 406.5±40.0 °C at 760 mmHg |
|---|
| Molecular Formula | C11H10O3S2 |
|---|
| Molecular Weight | 254.325 |
|---|
| Flash Point | 199.6±27.3 °C |
|---|
| Exact Mass | 254.007141 |
|---|
| PSA | 103.01000 |
|---|
| LogP | 2.36 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.624 |
|---|
| InChIKey | SYHWYWHVEQQDMO-UHFFFAOYSA-N |
|---|
| SMILES | COC(=O)C(O)(c1cccs1)c1cccs1 |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2934999090 |
|---|
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| methyl di(2-thyenil)glycolate |
| MFCD08458380 |
| 2-hydroxy-2,2-dithien-2-ylacetic acid methyl ester |
| 2-Thiopheneacetic acid, α-hydroxy-α-2-thienyl-, methyl ester |
| Methyl Di(2-thienylglycolate) |
| Methyl di(2-thienyl)glycolate |
| Methyl 2,2-dithienylglycolate |
| Methyl 2-hydroxy-2,2-di(2-thienyl)acetate |
| Methyl 2-Hydroxy-2,2-dithiophen-2-ylacetate |
| hydroxy-di-thiophen-2-yl-acetic acid methyl ester |
| T5SJ BXQVO1&- BT5SJ |
| methyl di-(2-thienyl)glycolate |
| Methyl hydroxy(dithiophen-2-yl)acetate |
| Methyl 2-hydroxy-2,2-di(thiophen-2-yl)acetate |
| Methyl 2,2-dithienyl glycolate |
| 2-hydroxy-2,2-di(thiophen-2'-yl)acetic acid methyl ester |
| Methyl hydroxy(di-2-thienyl)acetate |
| Methyl di(2-thienyl) glycolate |
| Methyl2,2-dithienyl glycolate |
| Tiotropium Bromide Impurity 5 |