Introduction：Basic information about CAS 85136-12-5|tert-butyl 5-oxo-L-prolinate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-butyl 5-oxo-L-prolinate |
|---|
| CAS Number | 85136-12-5 | Molecular Weight | 185.220 |
|---|
| Density | 1.1±0.1 g/cm3 | Boiling Point | 319.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H15NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 146.8±25.9 °C |
|---|
Names
| Name | (s)-2-pyrrolidone-5-carboxylic acid t-butyl ester |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.1±0.1 g/cm3 |
|---|
| Boiling Point | 319.2±35.0 °C at 760 mmHg |
|---|
| Molecular Formula | C9H15NO3 |
|---|
| Molecular Weight | 185.220 |
|---|
| Flash Point | 146.8±25.9 °C |
|---|
| Exact Mass | 185.105194 |
|---|
| PSA | 55.40000 |
|---|
| LogP | -0.70 |
|---|
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
|---|
| Index of Refraction | 1.467 |
|---|
| InChIKey | QXGSPAGZWRTTOT-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)C1CCC(=O)N1 |
|---|
Safety Information
Customs
| HS Code | 2933790090 |
|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
|---|
Synonyms
| 2-Methyl-2-propanyl 5-oxo-L-prolinate |
| tert-butyl (S)-5-oxo-pyrrolidine-2-carboxylate |
| tert-Butyl 5-oxo-2-pyrrolidinecarboxylate |
| (S)-2-Pyrrolidone-5-carboxylicacidtert-butylester |
| L-Proline, 5-oxo-, 1,1-dimethylethyl ester |
| Einecs 285-735-7 |
| tert-butyl 5-oxo-DL-prolinate |
| 5-Oxo-DL-proline 1,1-dimethylethyl ester |
| tert-butyl 5-oxo-L-prolinate |
| (2S)-5-oxo-proline tert-butyl ester |
| tert-butyl (2S)-5-oxo-pyrrolidine-2-carboxylate |
| tert-Butyl (S)-5-oxo-2-pyrrolidinecarboxylate |
| (2S)-tert-butyl 5-oxopyrrolidine-2-carboxylate |
| (S)-tert-butyl-5-oxopyrrolidine-2-carboxylate |
