Introduction:Basic information about CAS 808-12-8|1,2-Bis(4-methylphenyl)-1,2-diphenyl-1,2-ethanediol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1,2-Bis(4-methylphenyl)-1,2-diphenyl-1,2-ethanediol |
|---|
| CAS Number | 808-12-8 | Molecular Weight | 394.50500 |
|---|
| Density | 1.165g/cm3 | Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Molecular Formula | C28H26O2 | Melting Point | 156ºC |
|---|
| MSDS | / | Flash Point | 232.4ºC |
|---|
Names
| Name | 1,2-Bis(4-methylphenyl)-1,2-diphenyl-1,2-ethanediol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.165g/cm3 |
|---|
| Boiling Point | 534.1ºC at 760 mmHg |
|---|
| Melting Point | 156ºC |
|---|
| Molecular Formula | C28H26O2 |
|---|
| Molecular Weight | 394.50500 |
|---|
| Flash Point | 232.4ºC |
|---|
| Exact Mass | 394.19300 |
|---|
| PSA | 40.46000 |
|---|
| LogP | 5.47540 |
|---|
| Index of Refraction | 1.633 |
|---|
| InChIKey | YOCSNHRJFCUGEU-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C(O)(c2ccccc2)C(O)(c2ccccc2)c2ccc(C)cc2)cc1 |
|---|
Synonyms
| MFCD00026012 |
| 1,2-bis(4-methylphenyl)-1,2-diphenylethane-1,2-diol |