Introduction:Basic information about CAS 6797-44-0|1-phenyl-1,2,3-butanetrione 2-oxime, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1-phenyl-1,2,3-butanetrione 2-oxime |
|---|
| CAS Number | 6797-44-0 | Molecular Weight | 191.18300 |
|---|
| Density | 1.189g/cm3 | Boiling Point | 357.149ºC at 760 mmHg |
|---|
| Molecular Formula | C10H9NO3 | Melting Point | 128-130ºC |
|---|
| MSDS | / | Flash Point | 169.798ºC |
|---|
Names
| Name | 1-phenyl-1,2,3-butanetrione 2-oxime |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.189g/cm3 |
|---|
| Boiling Point | 357.149ºC at 760 mmHg |
|---|
| Melting Point | 128-130ºC |
|---|
| Molecular Formula | C10H9NO3 |
|---|
| Molecular Weight | 191.18300 |
|---|
| Flash Point | 169.798ºC |
|---|
| Exact Mass | 191.05800 |
|---|
| PSA | 66.73000 |
|---|
| LogP | 1.28850 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | UMQCXGGBHYGWTG-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)C(N=O)=C(O)c1ccccc1 |
|---|
Safety Information
| Hazard Codes | T+ |
|---|
| Risk Phrases | R36/37/38 |
|---|
| Safety Phrases | S26-S36 |
|---|
| HS Code | 2928000090 |
|---|
Customs
| HS Code | 2928000090 |
|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|---|
Synonyms
| hydroxyiminobenzoylacetone |
| 1-phenyl-1,2,3-butanetrione-2-oxime |
| MFCD00466576 |
| 2-Hydroxyimino-1-phenyl-1,3-butanedione |
| EINECS 229-869-6 |
| IBA~Isonitrosobenzoylacetone |
| 2-oximino-1-penyl-1,3-butanedione |
| ISO-NITROSOBENZOYL ACETONE |
| 1-phenylbutane-1,2,3-trione 2-oxime |
| 2,3-butanetrione,1-phenyl-2-oxime |
| 1-benzoylacetone 1-oxime |