Introduction:Basic information about CAS 121451-02-3|noviflumuron, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | noviflumuron |
|---|
| CAS Number | 121451-02-3 | Molecular Weight | 529.14100 |
|---|
| Density | 1.666g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C17H7Cl2F9N2O3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | noviflumuron |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.666g/cm3 |
|---|
| Molecular Formula | C17H7Cl2F9N2O3 |
|---|
| Molecular Weight | 529.14100 |
|---|
| Exact Mass | 527.96900 |
|---|
| PSA | 67.43000 |
|---|
| LogP | 6.70850 |
|---|
| Index of Refraction | 1.515 |
|---|
| InChIKey | YTYGAJLZOJPJGH-UHFFFAOYSA-N |
|---|
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1cc(Cl)c(OC(F)(F)C(F)C(F)(F)F)c(Cl)c1F |
|---|
Synonyms
| N-({[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino}carbonyl)-2,6-difluorobenzamide |
| N-[[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl]-2,6-difluorobenzamide |
| Noviflumuron |
| rac-N-({3,5-dichloro-2-fluoro-4-[(2R)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}carbamoyl)-2,6-difluorobenzamide |
| UNII-E99C7TUW20 |
| N-[[[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]amino]carbonyl]-2,6-difluorobenzamide |
| Noviflumuron [ISO] |
| 1-{3,5-dichloro-2-fluoro-4-[(RS)-1,1,2,3,3,3-hexafluoropropoxy]phenyl}-3-(2,6-difluorobenzoyl)urea |
| N-{[3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl]carbamoyl}-2,6-difluorobenzamide |
| Benzamide,N-(((3,5-dichloro-2-fluoro-4-(1,1,2,3,3,3-hexafluoropropoxy)phenyl)amino)carbonyl)-2,6-difluoro |