Introduction：Basic information about CAS 436099-84-2|4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-amine |
|---|
| CAS Number | 436099-84-2 | Molecular Weight | 230.28900 |
|---|
| Density | 1.48g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C11H10N4S | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 4-(2-methylimidazo[1,2-a]pyridin-3-yl)-1,3-thiazol-2-amine |
|---|
Chemical & Physical Properties
| Density | 1.48g/cm3 |
|---|
| Molecular Formula | C11H10N4S |
|---|
| Molecular Weight | 230.28900 |
|---|
| Exact Mass | 230.06300 |
|---|
| PSA | 84.45000 |
|---|
| LogP | 2.92960 |
|---|
| Index of Refraction | 1.784 |
|---|
| InChIKey | BBAPLOXSVGVGSI-UHFFFAOYSA-N |
|---|
| SMILES | Br.Br.Cc1nc2ccccn2c1-c1csc(N)n1 |
|---|
