Introduction：Basic information about CAS 122-27-0|Benzeneacetic acid,3-methylphenyl ester, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Benzeneacetic acid,3-methylphenyl ester |
|---|
| CAS Number | 122-27-0 | Molecular Weight | 226.27000 |
|---|
| Density | 1.108g/cm3 | Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 122.2ºC |
|---|
Names
| Name | (3-methylphenyl) 2-phenylacetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.108g/cm3 |
|---|
| Boiling Point | 359.1ºC at 760mmHg |
|---|
| Molecular Formula | C15H14O2 |
|---|
| Molecular Weight | 226.27000 |
|---|
| Flash Point | 122.2ºC |
|---|
| Exact Mass | 226.09900 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 3.14310 |
|---|
| Vapour Pressure | 2.44E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.569 |
|---|
| InChIKey | LSWZGOVODYFNQO-UHFFFAOYSA-N |
|---|
| SMILES | Cc1cccc(OC(=O)Cc2ccccc2)c1 |
|---|
Safety Information
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| Phenylacetic acid,3-methylphenyl ester |
| Phenyl-essigsaeure-m-tolylester |
| m-Tolyl phenylacetate |
| meta-Tolyl phenylacetate |
| EINECS 204-531-0 |
| Benzeneacetic acid,3-methylphenyl ester |
| 3-methylphenyl phenylacetate |
| m-Cresyl phenylacetate |
| Phenylacetic acid,m-tolyl ester |
