Introduction:Basic information about CAS 83071-67-4|[2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate |
|---|
| CAS Number | 83071-67-4 | Molecular Weight | 220.22100 |
|---|
| Density | >0 (vs air) | Boiling Point | / |
|---|
| Molecular Formula | C12H12O4 | Melting Point | 97-100ºC(lit.) |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol | GHS07 | Signal Word | Warning |
|---|
Names
| Name | [2-methoxy-4-[(Z)-3-oxoprop-1-enyl]phenyl] acetate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | >0 (vs air) |
|---|
| Melting Point | 97-100ºC(lit.) |
|---|
| Molecular Formula | C12H12O4 |
|---|
| Molecular Weight | 220.22100 |
|---|
| Exact Mass | 220.07400 |
|---|
| PSA | 52.60000 |
|---|
| LogP | 1.83260 |
|---|
| InChIKey | VEKAJHBFBMWJKI-ARJAWSKDSA-N |
|---|
| SMILES | COc1cc(C=CC=O)ccc1OC(C)=O |
|---|
Safety Information
| Symbol | GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H315-H319-H335 |
|---|
| Precautionary Statements | P261-P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 4-Acetoxy-3-methoxy-trans-zimtaldehyd |
| MFCD00239339 |
| 3-methoxy-4-acetoxycinnamaldehyde |
| 4-acetoxy-3-methoxy-trans-cinnamaldehyde |