Introduction：Basic information about CAS 55502-03-9|D-3-THIENYLALANINE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | D-3-THIENYLALANINE |
|---|
| CAS Number | 55502-03-9 | Molecular Weight | 274.11100 |
|---|
| Density | 1.458g/cm3 | Boiling Point | 165-170ºC (0.5 mmHg) |
|---|
| Molecular Formula | C10H12BrNO3 | Melting Point | 37-40ºC |
|---|
| MSDS | / | Flash Point | 186.7ºC |
|---|
Names
| Name | 1-(4-Bromobutoxy)-4-nitrobenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.458g/cm3 |
|---|
| Boiling Point | 165-170ºC (0.5 mmHg) |
|---|
| Melting Point | 37-40ºC |
|---|
| Molecular Formula | C10H12BrNO3 |
|---|
| Molecular Weight | 274.11100 |
|---|
| Flash Point | 186.7ºC |
|---|
| Exact Mass | 273.00000 |
|---|
| PSA | 55.05000 |
|---|
| LogP | 3.67190 |
|---|
| Index of Refraction | 1.563 |
|---|
| InChIKey | DBRBCFJUEVSKGZ-UHFFFAOYSA-N |
|---|
| SMILES | O=[N+]([O-])c1ccc(OCCCCBr)cc1 |
|---|
Safety Information
| Hazard Codes | Xn |
|---|
| Risk Phrases | 36/37/38-22 |
|---|
| Safety Phrases | 37/39-26 |
|---|
Synonyms
| 1-(4-bromobutoxy)-4-nitrobenzene |
| MFCD00980317 |
