Introduction:Basic information about CAS 148119-36-2|2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[3-(2-methoxyphenyl)-2-propenylidene]-, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[3-(2-methoxyphenyl)-2-propenylidene]- |
|---|
| CAS Number | 148119-36-2 | Molecular Weight | 272.25600 |
|---|
| Density | 1.374g/cm3 | Boiling Point | / |
|---|
| Molecular Formula | C14H12N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | / |
|---|
Names
| Name | 2,4,6(1H,3H,5H)-Pyrimidinetrione, 5-[3-(2-methoxyphenyl)-2-propenylidene] |
|---|
Chemical & Physical Properties
| Density | 1.374g/cm3 |
|---|
| Molecular Formula | C14H12N2O4 |
|---|
| Molecular Weight | 272.25600 |
|---|
| Exact Mass | 272.08000 |
|---|
| PSA | 84.50000 |
|---|
| LogP | 1.65840 |
|---|
| Index of Refraction | 1.669 |
|---|
| InChIKey | FFPOAFGKCXHOSX-GQCTYLIASA-N |
|---|
| SMILES | COc1ccccc1C=CC=C1C(=O)NC(=O)NC1=O |
|---|