Introduction：Basic information about CAS 128566-93-8|Ethyl 2-bromo-4-nitrobenzoate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Ethyl 2-bromo-4-nitrobenzoate |
|---|
| CAS Number | 128566-93-8 | Molecular Weight | 274.06800 |
|---|
| Density | / | Boiling Point | 350.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8BrNO4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 166ºC |
|---|
Names
| Name | Ethyl 2-bromo-4-nitrobenzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Boiling Point | 350.8ºC at 760 mmHg |
|---|
| Molecular Formula | C9H8BrNO4 |
|---|
| Molecular Weight | 274.06800 |
|---|
| Flash Point | 166ºC |
|---|
| Exact Mass | 272.96400 |
|---|
| PSA | 72.12000 |
|---|
| LogP | 3.05720 |
|---|
| Vapour Pressure | 4.29E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.576 |
|---|
| InChIKey | TYFRHNVPASRWLT-UHFFFAOYSA-N |
|---|
| SMILES | CCOC(=O)c1ccc([N+](=O)[O-])cc1Br |
|---|
Synonyms
| ethyl 2-bromo-4-methyl-thiazole-5-carboxylate |
| ethyl 2-Bromo-4-methyl-5-thiazolecarboxylate |
| Ethyl 2-bromo-4-nitro-benzoate |
| 2-bromo-4-methylthiazole-5-carboxylic acid ethyl ester |
| 2-Brom-4-methyl-thiazol-5-carbonsaeure-aethylester |
