Introduction：Basic information about CAS 68468-95-1|4-AMINO-3-(4-CHLOROPHENYL)-5-MERCAPTO-4H-1,2,4-TRIAZOLE, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-AMINO-3-(4-CHLOROPHENYL)-5-MERCAPTO-4H-1,2,4-TRIAZOLE |
|---|
| CAS Number | 68468-95-1 | Molecular Weight | 226.68600 |
|---|
| Density | 1.62g/cm3 | Boiling Point | 336.5ºC at 760 mmHg |
|---|
| Molecular Formula | C8H7ClN4S | Melting Point | 174-176ºC |
|---|
| MSDS | / | Flash Point | 157.3ºC |
|---|
Names
| Name | 4-amino-3-(4-chlorophenyl)-1H-1,2,4-triazole-5-thione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.62g/cm3 |
|---|
| Boiling Point | 336.5ºC at 760 mmHg |
|---|
| Melting Point | 174-176ºC |
|---|
| Molecular Formula | C8H7ClN4S |
|---|
| Molecular Weight | 226.68600 |
|---|
| Flash Point | 157.3ºC |
|---|
| Exact Mass | 226.00800 |
|---|
| PSA | 95.53000 |
|---|
| LogP | 2.18220 |
|---|
| Index of Refraction | 1.775 |
|---|
| InChIKey | OBKJAIJYUZQJFR-UHFFFAOYSA-N |
|---|
| SMILES | Nn1c(-c2ccc(Cl)cc2)n[nH]c1=S |
|---|
Synonyms
| F1219-1414 |
| 5-p-Chlorophenyl-4-amino-3-mercapto-1,2,4-triazole |
