Introduction：Basic information about CAS 879642-82-7|CHEMBRDG-BB 5967532, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | CHEMBRDG-BB 5967532 |
|---|
| CAS Number | 879642-82-7 | Molecular Weight | 288.72600 |
|---|
| Density | 1.302g/cm3 | Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 240.5ºC |
|---|
Names
| Name | 3-[4-[(4-chlorophenyl)methoxy]phenyl]prop-2-enoic acid |
|---|
Chemical & Physical Properties
| Density | 1.302g/cm3 |
|---|
| Boiling Point | 474.1ºC at 760 mmHg |
|---|
| Molecular Formula | C16H13ClO3 |
|---|
| Molecular Weight | 288.72600 |
|---|
| Flash Point | 240.5ºC |
|---|
| Exact Mass | 288.05500 |
|---|
| PSA | 46.53000 |
|---|
| LogP | 4.01680 |
|---|
| Index of Refraction | 1.638 |
|---|
| InChIKey | IRCGUVJWCKSXHE-BJMVGYQFSA-N |
|---|
| SMILES | O=C(O)C=Cc1ccc(OCc2ccc(Cl)cc2)cc1 |
|---|
