Introduction:Basic information about CAS 436099-83-1|furan-2-ylmethyl-(4-methyl-benzyl)-amine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | furan-2-ylmethyl-(4-methyl-benzyl)-amine |
|---|
| CAS Number | 436099-83-1 | Molecular Weight | 201.26400 |
|---|
| Density | / | Boiling Point | 296.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H15NO | Melting Point | / |
|---|
| MSDS | USA | Flash Point | 133ºC |
|---|
Names
| Name | furan-2-ylmethyl-(4-methyl-benzyl)-amine |
|---|
Chemical & Physical Properties
| Boiling Point | 296.3ºC at 760mmHg |
|---|
| Molecular Formula | C13H15NO |
|---|
| Molecular Weight | 201.26400 |
|---|
| Flash Point | 133ºC |
|---|
| Exact Mass | 201.11500 |
|---|
| PSA | 25.17000 |
|---|
| LogP | 3.26870 |
|---|
| Index of Refraction | 1.552 |
|---|
| InChIKey | LTKSRIGURQCUJV-UHFFFAOYSA-O |
|---|
| SMILES | Cc1ccc(C[NH2+]Cc2ccco2)cc1 |
|---|