Introduction：Basic information about CAS 68576-86-3|Enciprazine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Enciprazine |
|---|
| CAS Number | 68576-86-3 | Molecular Weight | 432.51000 |
|---|
| Density | 1.171g/cm3 | Boiling Point | 611.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H32N2O6 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 323.6ºC |
|---|
Names
| Name | 1-[4-(2-methoxyphenyl)piperazin-1-yl]-3-(3,4,5-trimethoxyphenoxy)propan-2-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.171g/cm3 |
|---|
| Boiling Point | 611.5ºC at 760 mmHg |
|---|
| Molecular Formula | C23H32N2O6 |
|---|
| Molecular Weight | 432.51000 |
|---|
| Flash Point | 323.6ºC |
|---|
| Exact Mass | 432.22600 |
|---|
| PSA | 72.86000 |
|---|
| LogP | 2.28580 |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | KSQCNASWXSCJTD-UHFFFAOYSA-N |
|---|
| SMILES | COc1ccccc1N1CCN(CC(O)COc2cc(OC)c(OC)c(OC)c2)CC1 |
|---|
Synonyms
| (RS)-enciprazine |
| Enciprazino |
| 1-[4-(2-methoxy-phenyl)-piperazin-1-yl]-3-(3,4,5-trimethoxy-phenoxy)-propan-2-ol |
| 1-(3,4,5-trimethoxyphenoxy)-3-<4-(2-methoxyphenyl)piperazinyl>propan-2-ol |
| Enciprazinum [INN-Latin] |
| Enciprazine |
| Enciprazine [INN:BAN] |
| Enciprazinum |
| Enciprazino [INN-Spanish] |
| 1-[3-(3,4,5-trimethoxyphenoxy)-2-hydroxypropyl]-4-(2-methoxyphenyl)-piperazine |
