Introduction：Basic information about CAS 70774-25-3|Leurubicin, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Leurubicin |
|---|
| CAS Number | 70774-25-3 | Molecular Weight | 656.67700 |
|---|
| Density | 1.49g/cm3 | Boiling Point | 916.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H40N2O12 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 507.9ºC |
|---|
Names
| Name | Leurubicin |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.49g/cm3 |
|---|
| Boiling Point | 916.2ºC at 760 mmHg |
|---|
| Molecular Formula | C33H40N2O12 |
|---|
| Molecular Weight | 656.67700 |
|---|
| Flash Point | 507.9ºC |
|---|
| Exact Mass | 656.25800 |
|---|
| PSA | 235.17000 |
|---|
| LogP | 1.62340 |
|---|
| Index of Refraction | 1.666 |
|---|
| InChIKey | HROXIDVVXKDCBD-ZUWKMVCBSA-N |
|---|
| SMILES | COc1cccc2c1C(=O)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(=O)CO)CC3OC1CC(NC(=O)C(N)CC(C)C)C(O)C(C)O1 |
|---|
Synonyms
| N-(L-Leucyl)doxorubicin |
| N-leucyldoxorubicin |
| leucine-doxorubicin |
| L-Leucyldoxorubicin |
