Introduction：Basic information about CAS 54657-98-6|Serfibrate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Serfibrate |
|---|
| CAS Number | 54657-98-6 | Molecular Weight | 373.85200 |
|---|
| Density | 1.307g/cm3 | Boiling Point | 600.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20ClNO5S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 317.1ºC |
|---|
Names
| Name | 3-acetamido-4-[2-(4-chlorophenoxy)-2-methylpropanoyl]sulfanylbutanoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.307g/cm3 |
|---|
| Boiling Point | 600.7ºC at 760 mmHg |
|---|
| Molecular Formula | C16H20ClNO5S |
|---|
| Molecular Weight | 373.85200 |
|---|
| Flash Point | 317.1ºC |
|---|
| Exact Mass | 373.07500 |
|---|
| PSA | 118.00000 |
|---|
| LogP | 3.12750 |
|---|
| Index of Refraction | 1.561 |
|---|
| InChIKey | FPCXDWYBOVVFFE-UHFFFAOYSA-N |
|---|
| SMILES | CC(=O)NC(CCSC(=O)C(C)(C)Oc1ccc(Cl)cc1)C(=O)O |
|---|
Synonyms
| Serfibrato |
| N-Acetyl-S-(2-(4-chlorophenoxy)-2-methyl-1-oxopropyl)homocystein |
| N-Acetyl-S-(2-(4-chlorophenoxy)-2-methylpropionyl)homocystein |
| Serfibratium |
| Serfibrat |
