Introduction：Basic information about CAS 54340-61-3|Brovanexine, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | Brovanexine |
|---|
| CAS Number | 54340-61-3 | Molecular Weight | 568.29800 |
|---|
| Density | 1.52g/cm3 | Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C24H28Br2N2O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 285ºC |
|---|
Names
| Name | (5S)-5-methyl-1-oxo-1,4-thiazinane-2-carboxylic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.52g/cm3 |
|---|
| Boiling Point | 547.6ºC at 760 mmHg |
|---|
| Molecular Formula | C24H28Br2N2O4 |
|---|
| Molecular Weight | 568.29800 |
|---|
| Flash Point | 285ºC |
|---|
| Exact Mass | 566.04200 |
|---|
| PSA | 67.87000 |
|---|
| LogP | 6.23530 |
|---|
| Index of Refraction | 1.626 |
|---|
| InChIKey | DQTRREPKGJIABH-UHFFFAOYSA-N |
|---|
| SMILES | COc1cc(C(=O)Nc2c(Br)cc(Br)cc2CN(C)C2CCCCC2)ccc1OC(C)=O |
|---|
Synonyms
| Cycloalliin |
| brovanexine |
| (5s)-5-methylthiomorpholine-2-carboxylic acid 1-oxide |
| Cycloallin |
| 3-Methyl-1,4-thiazane-5-carboxylic acid-1-oxide |
