Introduction:Basic information about CAS 114772-40-6|tert-Butyl 4'-(bromomethyl)biphenyl-2-carboxylate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | tert-Butyl 4'-(bromomethyl)biphenyl-2-carboxylate |
|---|
| CAS Number | 114772-40-6 | Molecular Weight | 347.246 |
|---|
| Density | 1.3±0.1 g/cm3 | Boiling Point | 437.0±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H19BrO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 218.1±26.8 °C |
|---|
Names
| Name | tert-butyl 2-[4-(bromomethyl)phenyl]benzoate |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.3±0.1 g/cm3 |
|---|
| Boiling Point | 437.0±38.0 °C at 760 mmHg |
|---|
| Molecular Formula | C18H19BrO2 |
|---|
| Molecular Weight | 347.246 |
|---|
| Flash Point | 218.1±26.8 °C |
|---|
| Exact Mass | 346.056824 |
|---|
| PSA | 26.30000 |
|---|
| LogP | 5.58 |
|---|
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
|---|
| Index of Refraction | 1.570 |
|---|
| InChIKey | YHXCWNQNVMAENQ-UHFFFAOYSA-N |
|---|
| SMILES | CC(C)(C)OC(=O)c1ccccc1-c1ccc(CBr)cc1 |
|---|
| Storage condition | 2-8°C |
|---|
Safety Information
| Hazard Codes | Xi |
|---|
| HS Code | 2916399090 |
|---|
Customs
| HS Code | 2916399090 |
|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|---|
Synonyms
| tert-Butyl α-bromo-2-(p-tolyl)benzoate |
| 2-Methyl-2-propanyl 4'-(bromomethyl)-2-biphenylcarboxylate |
| tert-Butyl 4'-(bromomethyl)-[1,1'-biphenyl]-2-carboxylate |
| tert-Butyl 4'-bromomethyl-2-biphenylcarboxylate |
| 4-bromomethyl-2'-tert-butoxycarbonylbiphenyl |
| MFCD06657561 |
| 1,1-Dimethylethyl 4'-(bromomethyl)-[1,1'-Biphenyl]-2-carboxylate |
| E1R DR BVOX1&1&1 |
| tert-Butyl 4′-(bromomethyl)biphenyl-2-carboxylate |
| α-Bromo-2-(p-tolyl)benzoic acid tert-butyl ester |
| 2-Boc-4'-(Bromomethyl)biphenyl |
| Tert-Butyl 4-(Bromomethyl)Biphenyl-2-Carboxylate |
| tert-butyl 4'-bromomethyl-biphenyl-2-carboxylate |
| [1,1'-Biphenyl]-2-carboxylic acid, 4'-(bromomethyl)-, 1,1-dimethylethyl ester |
| tert-Butyl 4'-(bromomethyl)biphenyl-2-carboxylate |
| Telmisartan Impurity 8 |