Introduction:Basic information about CAS 954259-78-0|2-Amino-N-(cyclopropylmethyl)benzenesulfonamide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Amino-N-(cyclopropylmethyl)benzenesulfonamide |
|---|
| CAS Number | 954259-78-0 | Molecular Weight | 226.29500 |
|---|
| Density | 1.318g/cm3 | Boiling Point | 404.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O2S | Melting Point | / |
|---|
| MSDS | / | Flash Point | 198.6ºC |
|---|
Names
| Name | 2-Amino-N-(cyclopropylmethyl)benzenesulfonamide |
|---|
Chemical & Physical Properties
| Density | 1.318g/cm3 |
|---|
| Boiling Point | 404.8ºC at 760 mmHg |
|---|
| Molecular Formula | C10H14N2O2S |
|---|
| Molecular Weight | 226.29500 |
|---|
| Flash Point | 198.6ºC |
|---|
| Exact Mass | 226.07800 |
|---|
| PSA | 80.57000 |
|---|
| LogP | 3.01000 |
|---|
| Index of Refraction | 1.607 |
|---|
| InChIKey | DAAXVEFVCCEUMV-UHFFFAOYSA-N |
|---|
| SMILES | Nc1ccccc1S(=O)(=O)NCC1CC1 |
|---|