Introduction：Basic information about CAS 14620-81-6|1H,1H-PERFLUORO-2,5,8-TRIMETHYL-3,6,9-TRIOXADODECAN-1-OL, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 1H,1H-PERFLUORO-2,5,8-TRIMETHYL-3,6,9-TRIOXADODECAN-1-OL |
|---|
| CAS Number | 14620-81-6 | Molecular Weight | 648.11300 |
|---|
| Density | 1.756g/cm3 | Boiling Point | 319.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H3F23O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 150.5ºC |
|---|
Names
| Name | 2,3,3,3-tetrafluoro-2-[1,1,2,3,3,3-hexafluoro-2-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]propoxy]propan-1-ol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.756g/cm3 |
|---|
| Boiling Point | 319.6ºC at 760mmHg |
|---|
| Molecular Formula | C12H3F23O4 |
|---|
| Molecular Weight | 648.11300 |
|---|
| Flash Point | 150.5ºC |
|---|
| Exact Mass | 647.96600 |
|---|
| PSA | 47.92000 |
|---|
| LogP | 6.68880 |
|---|
| Vapour Pressure | 2.75E-05mmHg at 25°C |
|---|
| Index of Refraction | 1.294 |
|---|
| InChIKey | IVWMVBZXKIOILW-UHFFFAOYSA-N |
|---|
| SMILES | OCC(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)F |
|---|
Synonyms
| PC6603 |
| 1H,1H-Perfluoro-2,5,8-trimethyl-3,6,9-trioxadodecan-1-ol |
| 1H,1H-Perfluoro-2,5,8-trimethyl-3,6,9-trioxaundecan-1-ol |
