Introduction：Basic information about CAS 73930-69-5|2-Chloro-3-(2-chloroethyl)-5,8-dimethylquinoline, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2-Chloro-3-(2-chloroethyl)-5,8-dimethylquinoline |
|---|
| CAS Number | 73930-69-5 | Molecular Weight | 254.15500 |
|---|
| Density | 1.236g/cm3 | Boiling Point | 378.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N | Melting Point | / |
|---|
| MSDS | / | Flash Point | 214.4ºC |
|---|
Names
| Name | 2-Chloro-3-(2-chloroethyl)-5,8-dimethylquinoline |
|---|
Chemical & Physical Properties
| Density | 1.236g/cm3 |
|---|
| Boiling Point | 378.2ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13Cl2N |
|---|
| Molecular Weight | 254.15500 |
|---|
| Flash Point | 214.4ºC |
|---|
| Exact Mass | 253.04300 |
|---|
| PSA | 12.89000 |
|---|
| LogP | 4.28630 |
|---|
| Index of Refraction | 1.608 |
|---|
| InChIKey | NKOLGUNGNROCGY-UHFFFAOYSA-N |
|---|
| SMILES | Cc1ccc(C)c2nc(Cl)c(CCCl)cc12 |
|---|
