Introduction：Basic information about CAS 351029-12-4|N-[3-(Trimethylsilyl)-2-propynyl]phthalimide, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | N-[3-(Trimethylsilyl)-2-propynyl]phthalimide |
|---|
| CAS Number | 351029-12-4 | Molecular Weight | 257.36000 |
|---|
| Density | / | Boiling Point | / |
|---|
| Molecular Formula | C14H15NO2Si | Melting Point | 131-136ºC |
|---|
| MSDS | ChineseUSA | Flash Point | / |
|---|
| Symbol |
GHS07 | Signal Word | Warning |
|---|
Names
| Name | 2-(3-trimethylsilylprop-2-ynyl)isoindole-1,3-dione |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Melting Point | 131-136ºC |
|---|
| Molecular Formula | C14H15NO2Si |
|---|
| Molecular Weight | 257.36000 |
|---|
| Exact Mass | 257.08700 |
|---|
| PSA | 37.38000 |
|---|
| LogP | 2.10130 |
|---|
| InChIKey | WANGPGFLDJMUCU-UHFFFAOYSA-N |
|---|
| SMILES | C[Si](C)(C)C#CCN1C(=O)c2ccccc2C1=O |
|---|
Safety Information
| Symbol |
GHS07 |
|---|
| Signal Word | Warning |
|---|
| Hazard Statements | H319 |
|---|
| Precautionary Statements | P305 + P351 + P338 |
|---|
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
|---|
| Hazard Codes | Xi |
|---|
| RIDADR | NONH for all modes of transport |
|---|
Synonyms
| 1-Phthalimido-3-(trimethylsilyl)propyne |
| 2-[3-(Trimethylsilyl)-2-propynyl]-1H-isoindole-1,3(2H)-dione |
| N-[(Trimethylsilyl)propargyl]phthalimide |
| N-[3-(Trimethylsilyl)-2-propynyl]phthalimide |
