Introduction:Basic information about CAS 4371-31-7|[1,1'-Biphenyl]-2,2',4,4'-tetrol, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | [1,1'-Biphenyl]-2,2',4,4'-tetrol |
|---|
| CAS Number | 4371-31-7 | Molecular Weight | 218.20500 |
|---|
| Density | 1.47g/cm3 | Boiling Point | 516.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O4 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 262.5ºC |
|---|
Names
| Name | 4-(2,4-dihydroxyphenyl)benzene-1,3-diol |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.47g/cm3 |
|---|
| Boiling Point | 516.1ºC at 760 mmHg |
|---|
| Molecular Formula | C12H10O4 |
|---|
| Molecular Weight | 218.20500 |
|---|
| Flash Point | 262.5ºC |
|---|
| Exact Mass | 218.05800 |
|---|
| PSA | 80.92000 |
|---|
| LogP | 2.17600 |
|---|
| Index of Refraction | 1.715 |
|---|
| InChIKey | CFGDTWRKBRQUFB-UHFFFAOYSA-N |
|---|
| SMILES | Oc1ccc(-c2ccc(O)cc2O)c(O)c1 |
|---|
Safety Information
Customs
| HS Code | 2906299090 |
|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|---|
Synonyms
| 4,4'-Biresorcinol |
| 2,2',4,4'-Biphenyltetrol |
| 2,4,2',4'-tetrahydroxy-1,1'-biphenyl |
| Biphenyl-2,4,2',4'-tetraol |
| 2:2':4:4'-tetrahydroxybiphenyl |
| [1,1'-biphenyl]-2,2',4,4'-tetrol |