Introduction：Basic information about CAS 7526-26-3|diphenyl methylphosphonate, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | diphenyl methylphosphonate |
|---|
| CAS Number | 7526-26-3 | Molecular Weight | 248.21400 |
|---|
| Density | 1.21 g/mL at 25ºC(lit.) | Boiling Point | 344.3ºC at 760 mmHg |
|---|
| Molecular Formula | C13H13O3P | Melting Point | 32.5-37.5ºC(lit.) |
|---|
| MSDS | / | Flash Point | 230 °F |
|---|
Names
| Name | [methyl(phenoxy)phosphoryl]oxybenzene |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.21 g/mL at 25ºC(lit.) |
|---|
| Boiling Point | 344.3ºC at 760 mmHg |
|---|
| Melting Point | 32.5-37.5ºC(lit.) |
|---|
| Molecular Formula | C13H13O3P |
|---|
| Molecular Weight | 248.21400 |
|---|
| Flash Point | 230 °F |
|---|
| Exact Mass | 248.06000 |
|---|
| PSA | 45.34000 |
|---|
| LogP | 3.96730 |
|---|
| Appearance of Characters | solid |
|---|
| Index of Refraction | 1.554 |
|---|
| InChIKey | HPUPGAFDTWIMBR-UHFFFAOYSA-N |
|---|
| SMILES | CP(=O)(Oc1ccccc1)Oc1ccccc1 |
|---|
Safety Information
| WGK Germany | 3 |
|---|
| RTECS | SZ9127500 |
|---|
Synonyms
| O,O-diphenyl methylphosphonate |
| methylphosphonic acid diphenylester |
| EINECS 231-388-1 |
| methanephosphonic acid diphenyl ester |
| diphenyl methylphosphonate |
| Phosphonic acid,methyl-,diphenyl ester |
| bisphenyl methylphosphonate |
