Introduction：Basic information about CAS 51127-25-4|DL-5-Benzoylamino-5-isopropyl-4-oxo-1,3-dioxane, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | DL-5-Benzoylamino-5-isopropyl-4-oxo-1,3-dioxane |
|---|
| CAS Number | 51127-25-4 | Molecular Weight | 263.28900 |
|---|
| Density | 1.2g/cm3 | Boiling Point | 495.2ºC at 760mmHg |
|---|
| Molecular Formula | C14H17NO4 | Melting Point | 161-162ºC |
|---|
| MSDS | / | Flash Point | 253.3ºC |
|---|
Names
| Name | DL-5-Benzoylamino-5-isopropyl-4-oxo-1,3-dioxane |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.2g/cm3 |
|---|
| Boiling Point | 495.2ºC at 760mmHg |
|---|
| Melting Point | 161-162ºC |
|---|
| Molecular Formula | C14H17NO4 |
|---|
| Molecular Weight | 263.28900 |
|---|
| Flash Point | 253.3ºC |
|---|
| Exact Mass | 263.11600 |
|---|
| PSA | 64.63000 |
|---|
| LogP | 1.73300 |
|---|
| Index of Refraction | 1.547 |
|---|
| InChIKey | NSURGGCELRNBSB-CQSZACIVSA-N |
|---|
| SMILES | CC(C)C1(NC(=O)c2ccccc2)COCOC1=O |
|---|
Synonyms
| dl-5-benzoylamino-5-isopropyl-4-oxo-1,3-dioxane,99 |
| MFCD01863311 |
