Introduction：Basic information about CAS 99473-14-0|(E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoic acid, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoic acid |
|---|
| CAS Number | 99473-14-0 | Molecular Weight | 321.41300 |
|---|
| Density | 1.132g/cm3 | Boiling Point | 495.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H23NO2 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 253.6ºC |
|---|
Names
| Name | (E)-2,2-dimethyl-7-[methyl(naphthalen-1-ylmethyl)amino]hept-5-en-3-ynoic acid |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.132g/cm3 |
|---|
| Boiling Point | 495.8ºC at 760mmHg |
|---|
| Molecular Formula | C21H23NO2 |
|---|
| Molecular Weight | 321.41300 |
|---|
| Flash Point | 253.6ºC |
|---|
| Exact Mass | 321.17300 |
|---|
| PSA | 40.54000 |
|---|
| LogP | 3.94200 |
|---|
| Index of Refraction | 1.612 |
|---|
| InChIKey | DSPCPJFHUUUMEV-XBXARRHUSA-N |
|---|
| SMILES | CN(CC=CC#CC(C)(C)C(=O)O)Cc1cccc2ccccc12 |
|---|
Synonyms
| E-Carboxyterbinafine |
| Carboxy Terbinafine |
| 5-Hepten-3-ynoic acid,2,2-dimethyl-7-(methyl(1-naphthalenylmethyl)amino)-,(E) |
| Carboxybutylterbinafine |
| (5E)-2,2-Dimethyl-7-[methyl(1-naphthalenylmethyl)amino]-5-hepten-3-ynoic Acid |
