Introduction：Basic information about CAS 5418-36-0|2,5-Cyclohexadien-1-one,4-[(4-hydroxy-2-methylphenyl)imino]-, sodium salt (1:1), including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 2,5-Cyclohexadien-1-one,4-[(4-hydroxy-2-methylphenyl)imino]-, sodium salt (1:1) |
|---|
| CAS Number | 5418-36-0 | Molecular Weight | 236.22200 |
|---|
| Density | 1.16g/cm3 | Boiling Point | 366.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H11NNaO2+ | Melting Point | / |
|---|
| MSDS | / | Flash Point | 175.5ºC |
|---|
Names
| Name | sodium,4-(4-hydroxyphenyl)imino-3-methylcyclohexa-2,5-dien-1-one |
|---|
Chemical & Physical Properties
| Density | 1.16g/cm3 |
|---|
| Boiling Point | 366.6ºC at 760mmHg |
|---|
| Molecular Formula | C13H11NNaO2+ |
|---|
| Molecular Weight | 236.22200 |
|---|
| Flash Point | 175.5ºC |
|---|
| Exact Mass | 236.06900 |
|---|
| PSA | 49.66000 |
|---|
| LogP | 2.46820 |
|---|
| Index of Refraction | 1.59 |
|---|
| InChIKey | KZMNIJMAXYPWOZ-UHFFFAOYSA-N |
|---|
| SMILES | CC1=CC(=O)C=CC1=Nc1ccc(O)cc1.[Na+] |
|---|
