Introduction：Basic information about CAS 5429-22-1|4-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one, including its chemical name, molecular formula, synonyms, physicochemical properties, and safety information, etc.
| Common Name | 4-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|
| CAS Number | 5429-22-1 | Molecular Weight | 279.29000 |
|---|
| Density | 1.18g/cm3 | Boiling Point | 434.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13NO3 | Melting Point | / |
|---|
| MSDS | / | Flash Point | 196.2ºC |
|---|
Names
| Name | 4-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5-one |
|---|
| Synonym | More Synonyms |
|---|
Chemical & Physical Properties
| Density | 1.18g/cm3 |
|---|
| Boiling Point | 434.8ºC at 760 mmHg |
|---|
| Molecular Formula | C17H13NO3 |
|---|
| Molecular Weight | 279.29000 |
|---|
| Flash Point | 196.2ºC |
|---|
| Exact Mass | 279.09000 |
|---|
| PSA | 47.89000 |
|---|
| LogP | 2.47530 |
|---|
| Index of Refraction | 1.594 |
|---|
| InChIKey | MGAHWEWWFYOBNW-RVDMUPIBSA-N |
|---|
| SMILES | COc1ccc(C=C2N=C(c3ccccc3)OC2=O)cc1 |
|---|
Safety Information
Customs
| HS Code | 2934999090 |
|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|---|
Synonyms
| 2-phenyl-4-(p-methoxybenzylidene)-5-oxazolone |
| (4-Methoxy-phenyl)-piperidin-4-yl-amine |
| 4-(4-methoxybenzylidene)-2-phenyl-5(4H)oxazolone |
| 4-p-methoxybenzylidene-2-phenyl-4,5-dihydro-1,3-oxazol-5-one |
| 4-(p-Anisidino)-piperidin |
| 4-p-Methoxyanilinopiperidin |
| 4-[(4-methoxyphenyl)methylidene]-2-phenyl-1,3-oxazol-5(4H)-one |
| 4-(4-methoxybenzylidene)-2-phenyl-4H-oxazol-5-one |
| 4-(4-methoxybenzylidene)-2-phenyloxazol-5(4H)-one |
